Benzene,1-nitro-4-(phenylmethyl) structure
|
Common Name | Benzene,1-nitro-4-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 1817-77-2 | Molecular Weight | 213.23200 | |
| Density | 1.18g/cm3 | Boiling Point | 351.9ºC at 760mmHg | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 164.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-benzyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 351.9ºC at 760mmHg |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23200 |
| Flash Point | 164.3ºC |
| Exact Mass | 213.07900 |
| PSA | 45.82000 |
| LogP | 3.70880 |
| Vapour Pressure | 8.06E-05mmHg at 25°C |
| Index of Refraction | n20/D 1.6040(lit.) |
| InChIKey | IDSGFSCSMXRJON-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cc2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 43 |
| Safety Phrases | 36/37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2904209090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-benzyl-4-nitro-benzene |
| 4-NitrodiphenylMethane |
| 4-benzyl-1-nitrobenzene |
| 4-Nitro-diphenylmethane |
| MFCD00024783 |
| p-Nitrodiphenylmethane |