Ciba C 9491 structure
|
Common Name | Ciba C 9491 | ||
|---|---|---|---|---|
| CAS Number | 18181-70-9 | Molecular Weight | 412.997 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 375.7±52.0 °C at 760 mmHg | |
| Molecular Formula | C8H8Cl2IO3PS | Melting Point | 72-73° (Beriger); mp 75° (Haddow) | |
| MSDS | Chinese USA | Flash Point | 181.0±30.7 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
Use of Ciba C 9491Iodofenphos is an obsolete insecticide once used for the protection of stored products, livestock pests and in public health applications. |
| Name | jodfenphos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.7±52.0 °C at 760 mmHg |
| Melting Point | 72-73° (Beriger); mp 75° (Haddow) |
| Molecular Formula | C8H8Cl2IO3PS |
| Molecular Weight | 412.997 |
| Flash Point | 181.0±30.7 °C |
| Exact Mass | 411.835327 |
| PSA | 69.59000 |
| LogP | 5.51 |
| Appearance of Characters | solid |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | LFVLUOAHQIVABZ-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1cc(Cl)c(I)cc1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H311-H400 |
| Precautionary Statements | P273-P280-P312 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | 21-50/53 |
| Safety Phrases | S60;S61;S36/S37 |
| RIDADR | UN2811 6.1/PG 3 |
| RTECS | TF0175000 |
| HS Code | 2920190090 |
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
[Experimental studies of the control of mosquitoes of the genus Anopheles using selected insecticides].
Wiad. Parazytol. 37(1) , 179-83, (1991) In the research 4 compounds: Iodofenphos, Propetamphos, Dioxacarb and Permethrin and two commercial insecticides: Pibutoks Super (Permethrin) and Safrotin 10 WP (Propetamphos) were used to control ano... |
|
|
[Determination of maximum permissible concentration of iodofenphos in the water reservoirs].
Gig. Sanit. (11) , 75-6, (1980)
|
|
|
[Control of flies and cockroaches in the zoo with Alfacron].
Wiad. Parazytol. 32(4-6) , 581-3, (1986)
|
| Thiophosphate de O-(2,5-dichloro-4-iodophényle) et de O,O-diméthyle |
| O-2,5-dichloro-4-iodophenyl O,O-dimethyl phosphorothioate |
| Trix |
| Nuvanol N |
| Compound C 9491 |
| Ciba C 9491 |
| Ciba-Geigy C 9491 |
| Phosphorothioic acid, O-(2,5-dichloro-4-iodophenyl) O,O-dimethyl ester |
| Iodophos |
| IODOFENPHOS |
| Alfacron |
| iodfenphos |
| Phosphorothioic Acid O-(2,5-Dichloro-4-iodophenyl) O,O-Dimethyl Ester |
| EINECS 242-069-1 |
| Jodfenphos |
| MFCD00055292 |
| O-(2,5-Dichloro-4-iodophenyl) O,O-dimethyl phosphorothioate |
| Iodophenphos |
| Iodofenfos |
| O-(2,5-Dichlor-4-iodphenyl)-O,O-dimethylthiophosphat |
| (2,5-dichloro-4-iodophenoxy)-dimethoxy-sulfanylidene-λ<sup>5</sup>-phosphane |