4-(dimethylamino)-1-(trifluoroacetyl)-pyridinium trifluoroacetate structure
|
Common Name | 4-(dimethylamino)-1-(trifluoroacetyl)-pyridinium trifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 181828-01-3 | Molecular Weight | 332.199 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10F6N2O3 | Melting Point | 102-103ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2,2-trifluoroethanone,2,2,2-trifluoroacetate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 102-103ºC(lit.) |
|---|---|
| Molecular Formula | C11H10F6N2O3 |
| Molecular Weight | 332.199 |
| Exact Mass | 332.059570 |
| PSA | 65.14000 |
| LogP | 0.02100 |
| InChIKey | GOSOPAPEXLJAEZ-UHFFFAOYSA-M |
| SMILES | CN(C)c1cc[n+](C(=O)C(F)(F)F)cc1.O=C([O-])C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
4-Dimethylamino-1-trifluoroacetylpyridinium Trifluoroacetate: An Efficient Reagent for the Preparation of Trifluoromethyl 1, 3-Dicarbonyl Compounds. Simchen G and Schmidt A.
ChemInform 28(23) , (1997)
|
| MFCD01321272 |
| 4-Dimethylamino-1-trifluoroacetylpyridinium trifluoroacetate |
| 1-(Trifluoroacetyl)-4-(dimethylamino)pyridinium Trifluoroacetate |
| 4-(Dimethylamino)-1-(trifluoroacetyl)pyridinium trifluoroacetate |