2-[4-[(4-Nitrophenyl)methoxy]phenyl]ethyl Ester Carbamimidothioic Acid structure
|
Common Name | 2-[4-[(4-Nitrophenyl)methoxy]phenyl]ethyl Ester Carbamimidothioic Acid | ||
|---|---|---|---|---|
| CAS Number | 182004-64-4 | Molecular Weight | 427.50 | |
| Density | 1.52±0.1 g/cm3 | Boiling Point | 98.4±23.0 °C | |
| Molecular Formula | C16H17N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.1±32.9 °C | |
| Name | KB-R7943 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52±0.1 g/cm3 |
|---|---|
| Boiling Point | 98.4±23.0 °C |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 427.50 |
| Flash Point | 277.1±32.9 °C |
| Exact Mass | 331.099060 |
| LogP | 3.23 |
| Appearance of Characters | powder |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | UMJUNUMSJDTYTM-UHFFFAOYSA-N |
| SMILES | N=C(N)SCCc1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1 |
| Storage condition | 2-8°C |
| Water Solubility | DMSO: >10mg/mL |
| K168065 |
| 2-{4-[(4-Nitrobenzyl)oxy]phenyl}ethyl carbamimidothioate |
| Carbamimidothioic acid, 2-[4-[(4-nitrophenyl)methoxy]phenyl]ethyl ester |
| carbamimidothioic acid 2-[4-[(4-nitrophenyl)methoxy]phenyl]ethyl ester |