Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl
Modify Date: 2025-09-13 18:30:54
Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl structure
|
Common Name | Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl | ||
|---|---|---|---|---|
| CAS Number | 1823402-74-9 | Molecular Weight | 266.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12BrNO |
|---|---|
| Molecular Weight | 266.13 |
| InChIKey | DXCPHSPTISZNLN-UHFFFAOYSA-N |
| SMILES | Cc1oc(-c2ccccc2)nc1C(C)Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl? |
| A: Molecular formula of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl is C12H12BrNO. |
| Q: What is the CAS number of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl? |
| A: CAS number of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl is 1823402-74-9. |
| Q: What is the InChIKey of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl? |
| A: InChIKey of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl is DXCPHSPTISZNLN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1823402-74-9? |
| A: Chinese name of 1823402-74-9 is 1823402-74-9. |
| Q: What is the English name of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl? |
| A: The English name of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl is Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl. |
| Q: What is the molecular weight of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl? |
| A: Molecular weight of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl is 266.13. |
| Q: What is the SMILES notation of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl? |
| A: SMILES notation of Oxazole, 4-(1-bromoethyl)-5-methyl-2-phenyl is Cc1oc(-c2ccccc2)nc1C(C)Br. |