dichloro-[(4-methoxyphenyl)methyl]silane
![dichloro-[(4-methoxyphenyl)methyl]silane Structure](https://image.chemsrc.com/caspic/226/18236-55-0.png)
dichloro-[(4-methoxyphenyl)methyl]silane structure
|
Common Name | dichloro-[(4-methoxyphenyl)methyl]silane | ||
|---|---|---|---|---|
| CAS Number | 18236-55-0 | Molecular Weight | 221.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10Cl2OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dichloro-[(4-methoxyphenyl)methyl]silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10Cl2OSi |
|---|---|
| Molecular Weight | 221.15600 |
| Exact Mass | 219.98800 |
| PSA | 9.23000 |
| LogP | 2.74140 |
| InChIKey | LNNAJUFBYUNPCK-UHFFFAOYSA-N |
| SMILES | COc1ccc(C[SiH](Cl)Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
dichloro-[(4-me... CAS#:18236-55-0 |
| Literature: Golubev, Oleg; Panov, Dmitri; Ploom, Anu; Tuulmets, Ants; Nguyen, Binh T. Journal of Organometallic Chemistry, 2007 , vol. 692, # 17 p. 3700 - 3705 |
|
~%
dichloro-[(4-me... CAS#:18236-55-0 |
| Literature: Lasocki,Z. Bulletin de l'Academie Polonaise des Sciences, Serie des Sciences Chimiques, 1964 , vol. 12, p. 281 - 287 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl-4-methoxyphenyl-dichlorosilane |
| Dichlor-methyl-<4-methoxy-phenyl>-silan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of dichloro-[(4-methoxyphenyl)methyl]silane? |
| A: Molecular weight of dichloro-[(4-methoxyphenyl)methyl]silane is 221.15600. |
| Q: What is the English name of dichloro-[(4-methoxyphenyl)methyl]silane? |
| A: The English name of dichloro-[(4-methoxyphenyl)methyl]silane is dichloro-[(4-methoxyphenyl)methyl]silane. |
| Q: What is the CAS number of dichloro-[(4-methoxyphenyl)methyl]silane? |
| A: CAS number of dichloro-[(4-methoxyphenyl)methyl]silane is 18236-55-0. |
| Q: What is the InChIKey of dichloro-[(4-methoxyphenyl)methyl]silane? |
| A: InChIKey of dichloro-[(4-methoxyphenyl)methyl]silane is LNNAJUFBYUNPCK-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of dichloro-[(4-methoxyphenyl)methyl]silane? |
| A: Polar surface area (PSA) of dichloro-[(4-methoxyphenyl)methyl]silane is 9.23000. |
| Q: What English synonyms does dichloro-[(4-methoxyphenyl)methyl]silane have? |
| A: English synonyms of dichloro-[(4-methoxyphenyl)methyl]silane: methyl-4-methoxyphenyl-dichlorosilane, Dichlor-methyl--silan. |
| Q: What is the SMILES notation of dichloro-[(4-methoxyphenyl)methyl]silane? |
| A: SMILES notation of dichloro-[(4-methoxyphenyl)methyl]silane is COc1ccc(C[SiH](Cl)Cl)cc1. |
| Q: What is the Chinese name of 18236-55-0? |
| A: Chinese name of 18236-55-0 is 18236-55-0. |
| Q: What is the LogP of dichloro-[(4-methoxyphenyl)methyl]silane? |
| A: LogP of dichloro-[(4-methoxyphenyl)methyl]silane is 2.74140. |
| Q: What is the molecular formula of dichloro-[(4-methoxyphenyl)methyl]silane? |
| A: Molecular formula of dichloro-[(4-methoxyphenyl)methyl]silane is C8H10Cl2OSi. |