pentachlorobenzoyl chloride structure
|
Common Name | pentachlorobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1825-23-6 | Molecular Weight | 312.79200 | |
| Density | 1.781 g/cm3 | Boiling Point | 335.4ºC at 760 mmHg | |
| Molecular Formula | C7Cl6O | Melting Point | 83-85ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4,5,6-pentachlorobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.781 g/cm3 |
|---|---|
| Boiling Point | 335.4ºC at 760 mmHg |
| Melting Point | 83-85ºC |
| Molecular Formula | C7Cl6O |
| Molecular Weight | 312.79200 |
| Exact Mass | 309.80800 |
| PSA | 17.07000 |
| LogP | 5.33260 |
| InChIKey | AAUSLOKBERXEER-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2916399090 |
|---|
|
~92%
pentachlorobenz... CAS#:1825-23-6 |
| Literature: Bayer Aktiengesellschaft Patent: US4330366 A1, 1982 ; |
|
~59%
pentachlorobenz... CAS#:1825-23-6 |
| Literature: Ruberu, Shiyamalie; Fox, Marye Anne Journal of Physical Chemistry, 1993 , vol. 97, # 1 p. 143 - 149 |
|
~%
pentachlorobenz... CAS#:1825-23-6 |
| Literature: Weidenbruch,M.; Boeke,S. Chemische Berichte, 1970 , vol. 103, p. 510 - 515 |
|
~6%
Detail
|
| Literature: Ruberu, Shiyamalie; Fox, Marye Anne Journal of Physical Chemistry, 1993 , vol. 97, # 1 p. 143 - 149 |
|
~%
pentachlorobenz... CAS#:1825-23-6 |
| Literature: Kirpal; Kunze Chemische Berichte, 1929 , vol. 62, p. 2103,2105 |
|
~%
pentachlorobenz... CAS#:1825-23-6 |
| Literature: Kirpal; Kunze Chemische Berichte, 1929 , vol. 62, p. 2103,2105 |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| T0500-2251 |
| benzoyl perchloride |
| Pentachlorbenzoesaeurechlorid |
| perchlorobenzoylchloride |
| Pentachlor-benzoylchlorid |
| pentachloro-benzoyl chloride |