2,3,4,5,6-pentachloro(trifluoromethyl) benzene structure
|
Common Name | 2,3,4,5,6-pentachloro(trifluoromethyl) benzene | ||
|---|---|---|---|---|
| CAS Number | 384-83-8 | Molecular Weight | 318.33500 | |
| Density | 1.742 g/cm3 | Boiling Point | 279ºC at 760 mmHg | |
| Molecular Formula | C7Cl5F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140ºC | |
| Name | 1,2,3,4,5-pentachloro-6-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.742 g/cm3 |
|---|---|
| Boiling Point | 279ºC at 760 mmHg |
| Molecular Formula | C7Cl5F3 |
| Molecular Weight | 318.33500 |
| Flash Point | 140ºC |
| Exact Mass | 315.83900 |
| LogP | 5.97240 |
| Index of Refraction | 1.521 |
| InChIKey | OFYUASAFKNCGBJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2903999090 |
|---|
|
~77%
2,3,4,5,6-penta... CAS#:384-83-8 |
| Literature: Castaner, J.; Riera, J.; Carilla, J.; Robert, A.; Molins, E.; Miravitlles, C. Journal of Organic Chemistry, 1991 , vol. 56, # 1 p. 103 - 110 |
|
~98%
2,3,4,5,6-penta... CAS#:384-83-8 |
| Literature: Castaner, J.; Riera, J.; Carilla, J.; Robert, A.; Molins, E.; Miravitlles, C. Journal of Organic Chemistry, 1991 , vol. 56, # 1 p. 103 - 110 |
|
~%
2,3,4,5,6-penta... CAS#:384-83-8 |
| Literature: Ethyl Corp. Patent: US2654789 , 1948 ; |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,pentachloro(trifluoromethyl) |
| Pentachlor-trifluormethyl-benzol |
| Benzene,1,2,3,4,5-pentachloro-6-(trifluoromethyl) |
| U649 |
| 2,3,4,5,6-pentachloro-1-(trifluoromethyl)benzene |
| pentachlorobenzotrifluoride |
| Pentachlor-benzo-trifluorid |
| 2,3,4,5,6-Pentachloro(trifluoromethyl)benzene |
| pentachloro-trifluoromethyl-benzene |