Acetamide,2,2,2-trichloro-N-(2,2,2-trichloro-1-hydroxyethyl)- structure
|
Common Name | Acetamide,2,2,2-trichloro-N-(2,2,2-trichloro-1-hydroxyethyl)- | ||
|---|---|---|---|---|
| CAS Number | 18271-89-1 | Molecular Weight | 309.79000 | |
| Density | 1.857g/cm3 | Boiling Point | 342.4ºC at 760mmHg | |
| Molecular Formula | C4H3Cl6NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.9ºC | |
| Name | 2,2,2-trichloro-N-(2,2,2-trichloro-1-hydroxyethyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.857g/cm3 |
|---|---|
| Boiling Point | 342.4ºC at 760mmHg |
| Molecular Formula | C4H3Cl6NO2 |
| Molecular Weight | 309.79000 |
| Flash Point | 160.9ºC |
| Exact Mass | 306.82900 |
| PSA | 49.33000 |
| LogP | 2.55230 |
| Vapour Pressure | 4.92E-06mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | PEQMUUMLEPJMCU-UHFFFAOYSA-N |
| SMILES | O=C(NC(O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| HS Code | 2924199090 |
|---|
|
~%
Acetamide,2,2,2... CAS#:18271-89-1 |
| Literature: Kasper, Franz; Boettger, Holger Zeitschrift fuer Chemie (Stuttgart, Germany), 1987 , vol. 27, # 2 p. 70 - 71 |
|
~%
Acetamide,2,2,2... CAS#:18271-89-1 |
| Literature: Farbw. Hoechst. Patent: DE949946 , 1952 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Trichloressigsaeure-trichloraethanolamid |
| Chloral-2-trichloracetamid |