Benzenesulfonic acid,4-nitro-, 1-methylethyl ester structure
|
Common Name | Benzenesulfonic acid,4-nitro-, 1-methylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1830-67-7 | Molecular Weight | 245.25200 | |
| Density | 1.341g/cm3 | Boiling Point | 375.6ºC at 760 mmHg | |
| Molecular Formula | C9H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.9ºC | |
| Name | propan-2-yl 4-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 375.6ºC at 760 mmHg |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.25200 |
| Flash Point | 180.9ºC |
| Exact Mass | 245.03600 |
| PSA | 97.57000 |
| LogP | 3.31250 |
| Vapour Pressure | 1.67E-05mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | SKEMEAIANCBOLC-UHFFFAOYSA-N |
| SMILES | CC(C)OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
Benzenesulfonic... CAS#:1830-67-7 |
| Literature: Pasto, Daniel J.; Cottard, Francois; Jumelle, Laurent Journal of the American Chemical Society, 1994 , vol. 116, # 20 p. 8978 - 8984 |
|
~%
Benzenesulfonic... CAS#:1830-67-7 |
| Literature: Ninomiya; Kohda; Kawazoe Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 4 p. 1326 - 1332 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| p-Nitrobenzolsulfonsaeureisopropylester |
| Isopropyl-4-nitro-benzolsulfonat |
| 4-nitro-benzenesulfonic acid isopropyl ester |
| Isopropyl p-nitrobenzenesulfonate |
| 2-propyl nosylate |
| 2-propyl 4-nitrobenzenesulfonate |
| 4-Nitro-benzolsulfonsaeure-isopropylester |