3,3,5-TRIBROMO-1H-PYRROLO[2,3-B]PYRIDIN-2(3H)-ONE structure
|
Common Name | 3,3,5-TRIBROMO-1H-PYRROLO[2,3-B]PYRIDIN-2(3H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 183208-32-4 | Molecular Weight | 370.82400 | |
| Density | 2.512g/cm3 | Boiling Point | 411.396ºC at 760 mmHg | |
| Molecular Formula | C7H3Br3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.605ºC | |
| Name | 3,3,5-tribromo-1H-pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.512g/cm3 |
|---|---|
| Boiling Point | 411.396ºC at 760 mmHg |
| Molecular Formula | C7H3Br3N2O |
| Molecular Weight | 370.82400 |
| Flash Point | 202.605ºC |
| Exact Mass | 367.78000 |
| PSA | 41.99000 |
| LogP | 2.87680 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.724 |
| InChIKey | PBCSUZHEJACRDJ-UHFFFAOYSA-N |
| SMILES | O=C1Nc2ncc(Br)cc2C1(Br)Br |
| HS Code | 2933990090 |
|---|
|
~86%
3,3,5-TRIBROMO-... CAS#:183208-32-4 |
| Literature: WO2003/82869 A1, ; Page/Page column 23 ; WO 03/082869 A1 |
|
~86%
3,3,5-TRIBROMO-... CAS#:183208-32-4 |
| Literature: Heterocycles, , vol. 50, # 2 p. 1065 - 1080 |
|
~30%
3,3,5-TRIBROMO-... CAS#:183208-32-4 |
| Literature: WO2005/5378 A2, ; Page/Page column 43 ; WO 2005/005378 A2 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,3,5-tribromo-2-oxo-7-azaindoline |