Nuezhenidic acid structure
|
Common Name | Nuezhenidic acid | ||
|---|---|---|---|---|
| CAS Number | 183238-67-7 | Molecular Weight | 452.37 | |
| Density | 1.70±0.1 g/cm3 (20 ºC 760 Torr) | Boiling Point | N/A | |
| Molecular Formula | C17H24O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nuezhenidic acidNuezhenidic acid, isolated from the fruits of Ligustrum lucidum, posseses inhibitory activities against influenza A virus[1]. |
| Name | Nüzhendic acid |
|---|
| Description | Nuezhenidic acid, isolated from the fruits of Ligustrum lucidum, posseses inhibitory activities against influenza A virus[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.70±0.1 g/cm3 (20 ºC 760 Torr) |
|---|---|
| Molecular Formula | C17H24O14 |
| Molecular Weight | 452.37 |
| InChIKey | ZGRZULFRVWCUPF-XQCFPTMUSA-N |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C(O)(CC(=O)O)C1CC(=O)O |