neocaesalpin AH structure
|
Common Name | neocaesalpin AH | ||
|---|---|---|---|---|
| CAS Number | 18326-06-2 | Molecular Weight | 414.49 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 498.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C24H30O6 | Melting Point | 191-192℃ | |
| MSDS | N/A | Flash Point | 255.4±28.7 °C | |
Use of neocaesalpin AH2-Acetoxy-3-deacetoxycaesaldekarin e (compound 11) is a furanoditerpene that can be found in Caesalpinia crista[1]. |
| Name | (1R,2S,4aR,11bS)-4a-hydroxy-4,4,7,11b-tetramethyl-1,2,3,4,4a,5,6,11b-octahydrophenanthro[3,2-b]furan-1,2-diyl diacetate |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Acetoxy-3-deacetoxycaesaldekarin e (compound 11) is a furanoditerpene that can be found in Caesalpinia crista[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.7±45.0 °C at 760 mmHg |
| Melting Point | 191-192℃ |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.49 |
| Flash Point | 255.4±28.7 °C |
| Exact Mass | 414.204254 |
| PSA | 85.97000 |
| LogP | 4.94 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | FETPRYGDJQBBEF-KOVSNXQUSA-N |
| SMILES | CC(=O)OC1CC(C)(C)C2(O)CCc3c(cc4occc4c3C)C2(C)C1OC(C)=O |
| Hazard Codes | Xi |
|---|
| (1R,2S,4aR,11bS)-4a-Hydroxy-4,4,7,11b-tetramethyl-1,2,3,4,4a,5,6,11b-octahydrophenanthro[3,2-b]furan-1,2-diyl diacetate |
| neocaesalpin AH |
| Phenanthro[3,2-b]furan-1,2,4a(2H)-triol, 1,3,4,5,6,11b-hexahydro-4,4,7,11b-tetramethyl-, 1,2-diacetate, (1R,2S,4aR,11bS)- |