(Trifluoroacetyl)benzotriazole structure
|
Common Name | (Trifluoroacetyl)benzotriazole | ||
|---|---|---|---|---|
| CAS Number | 183266-61-7 | Molecular Weight | 215.13200 | |
| Density | 1.58g/cm3 | Boiling Point | 243.8ºC at 760 mmHg | |
| Molecular Formula | C8H4F3N3O | Melting Point | 66-70ºC(lit.) | |
| MSDS | N/A | Flash Point | 101.3ºC | |
| Name | 1-(benzotriazol-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 243.8ºC at 760 mmHg |
| Melting Point | 66-70ºC(lit.) |
| Molecular Formula | C8H4F3N3O |
| Molecular Weight | 215.13200 |
| Flash Point | 101.3ºC |
| Exact Mass | 215.03100 |
| PSA | 47.78000 |
| LogP | 1.63380 |
| Vapour Pressure | 0.0314mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | GVQIQOIKWUOEJP-UHFFFAOYSA-N |
| SMILES | O=C(n1nnc2ccccc21)C(F)(F)F |
| WGK Germany | 3 |
|---|
|
~%
(Trifluoroacety... CAS#:183266-61-7 |
| Literature: Chisso Corporation Patent: US6685995 B1, 2004 ; |
|
~99%
(Trifluoroacety... CAS#:183266-61-7 |
| Literature: Katritzky, Alan R.; Yang, Baozhen; Semenzin, Delphine Journal of Organic Chemistry, 1997 , vol. 62, # 3 p. 726 - 728 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| 1-(trifluoroacetyl)-1H-benzotriazole |
| 1h-benzotriazole,1-(trifluoroacetyl) |
| 1-(trifluoroacetyl)benzotriazole |
| TFABI |
| MFCD00593044 |
| 1-(Trifluoromethyl)acetylbenzotriazole |
| trifluoroacetyl benzotriazole |
| N-Trifluoroacetylbenzotriazole |