BTR-1 structure
|
Common Name | BTR-1 | ||
|---|---|---|---|---|
| CAS Number | 18331-34-5 | Molecular Weight | 249.35200 | |
| Density | 1.34g/cm3 | Boiling Point | 372.8ºC at 760mmHg | |
| Molecular Formula | C12H11NOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.3ºC | |
Use of BTR-1BTR-1 is an active anti-cancer agent, causes S phase arrest, and affects DNA replication in leukemic cells. BTR-1 activates apoptosis and induces cell death[1]. |
| Name | 5-benzylidene-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | BTR-1 is an active anti-cancer agent, causes S phase arrest, and affects DNA replication in leukemic cells. BTR-1 activates apoptosis and induces cell death[1]. |
|---|---|
| Related Catalog | |
| Target |
Apoptosis[1] |
| References |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 372.8ºC at 760mmHg |
| Molecular Formula | C12H11NOS2 |
| Molecular Weight | 249.35200 |
| Flash Point | 179.3ºC |
| Exact Mass | 249.02800 |
| PSA | 77.70000 |
| LogP | 2.84560 |
| Vapour Pressure | 9.34E-06mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | ZQDPYAPUFMILTB-NTMALXAHSA-N |
| SMILES | CCN1C(=O)C(=Cc2ccccc2)SC1=S |
| Storage condition | 2-8℃ |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-ethyl-5-benzylidene-2-thioxo-thiazolidin-4-one |
| 3-Aethyl-5-benzyliden-2-thioxo-thiazolidin-4-on |
| 3-Ethyl-5-benzyliden-rhodanin |
| 5-benzylidene-3-ethyl rhodanine |