3-bromo-6-chloro-8-nitroquinoline structure
|
Common Name | 3-bromo-6-chloro-8-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 183543-61-5 | Molecular Weight | 287.49700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4BrClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-6-chloro-8-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H4BrClN2O2 |
|---|---|
| Molecular Weight | 287.49700 |
| Exact Mass | 285.91400 |
| PSA | 58.71000 |
| LogP | 4.08210 |
| InChIKey | COVFYLACFRNJLF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)cc2cc(Br)cnc12 |
| HS Code | 2933499090 |
|---|
|
~99%
3-bromo-6-chlor... CAS#:183543-61-5 |
| Literature: Gershon; Clarke Monatshefte fur Chemie, 1996 , vol. 127, # 3 p. 331 - 337 |
|
~%
3-bromo-6-chlor... CAS#:183543-61-5 |
| Literature: Baker et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 393 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Brom-6-chlor-8-nitro-chinolin |
| 3-bromo-6-chloro-8-nitro-quinoline |