4-Chloro-2-nitroaniline structure
|
Common Name | 4-Chloro-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 89-63-4 | Molecular Weight | 172.569 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 308.8±22.0 °C at 760 mmHg | |
| Molecular Formula | C6H5ClN2O2 | Melting Point | 117-119 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 140.5±22.3 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 4-Chloro-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.8±22.0 °C at 760 mmHg |
| Melting Point | 117-119 °C(lit.) |
| Molecular Formula | C6H5ClN2O2 |
| Molecular Weight | 172.569 |
| Flash Point | 140.5±22.3 °C |
| Exact Mass | 172.003952 |
| PSA | 71.84000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | PBGKNXWGYQPUJK-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)cc1[N+](=O)[O-] |
| Water Solubility | INSOLUBLE |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H310 + H330-H373-H411 |
| Precautionary Statements | P260-P264-P273-P280-P284-P301 + P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+:Verytoxic;N:Dangerous for the environment; |
| Risk Phrases | R26/27/28;R33;R51/53 |
| Safety Phrases | S28-S36/37-S45-S61-S28A |
| RIDADR | UN 2237 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | BX1575000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29214210 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
[Toxicity of 4-chloro-2-nitroaniline and 2-chloro-4-nitroaniline to isolated rat hepatocytes].
Med. Lav. 82(3) , 253-60, (1991) The toxicity of 4-chloro-2-nitroaniline (4C2NA) and 2-chloro-4-nitroaniline (2C4NA) was investigated on isolated rat hepatocytes following 1-3 hours of exposure to 0.2 and/or 2 mM of these xenobiotics... |
|
|
Disposition and metabolism of 4-chloro-2-nitroaniline in the male F344 rat.
J. Toxicol. Environ. Health A 12(2-3) , 267-82, (1983) The disposition and metabolism of 14C-labeled 4-chloro-2-nitroaniline (CNA) was studied in male F344 rats following oral or intravenous (iv) administration. The gastrointestinal absorption of CNA was ... |
| 4-chloro-2-nitro-phenylamine |
| 4-chloro-2-nitro-aniline |
| Red Salt Ciba VI |
| 2-Nitro-4-chloroaniline |
| Benzenamine,4-chloro-2-nitro |
| Devol Red Salt F |
| Red Base Ciba VI |
| ZR DG BNW |
| EINECS 201-925-4 |
| 1-amino-2-nitro-4-chlorobenzene |
| MFCD00007836 |
| Aniline,4-chloro-2-nitro |
| 4-Chloro-2-nitroaniline |
| Red Salt Nbgl |
| 4-Chloro-2-nitrobenzenamine |
| Devol Red F |
| Red Base Irga VI |
| azoamine red 2C |