Pomalidomide-PEG6-butyl iodide
Modify Date: 2025-08-27 11:42:34
Pomalidomide-PEG6-butyl iodide structure
|
Common Name | Pomalidomide-PEG6-butyl iodide | ||
|---|---|---|---|---|
| CAS Number | 1835705-74-2 | Molecular Weight | 761.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H44IN3O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pomalidomide-PEG6-butyl iodidePomalidomide-PEG6-butyl iodide is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and 6-unit PEG linker used in PROTAC technology[1]. |
| Name | Pomalidomide-PEG6-butyl iodide |
|---|
| Description | Pomalidomide-PEG6-butyl iodide is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and 6-unit PEG linker used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C31H44IN3O11 |
|---|---|
| Molecular Weight | 761.60 |
| InChIKey | NPWUUZRWHPEICJ-UHFFFAOYSA-N |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NC(=O)COCCOCCOCCOCCOCCOCCCCCCI)c3C2=O)C(=O)N1 |