CYN 154806
Modify Date: 2025-08-23 13:51:23
CYN 154806 structure
|
Common Name | CYN 154806 | ||
|---|---|---|---|---|
| CAS Number | 183658-72-2 | Molecular Weight | 1197.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C56H68N12O14S2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of CYN 154806CYN 154806, a cyclic octapeptide, is a potent and selective somatostatin sst2 receptor antagonist, with pIC50 values of 8.58, 5.41, 6.07, 5.76 and 6.48 for human recombinant sst2, sst1, sst3, sst4 and sst5 receptors respectively[1][2]. |
| Name | cyn 154806 |
|---|
| Description | CYN 154806, a cyclic octapeptide, is a potent and selective somatostatin sst2 receptor antagonist, with pIC50 values of 8.58, 5.41, 6.07, 5.76 and 6.48 for human recombinant sst2, sst1, sst3, sst4 and sst5 receptors respectively[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Somatostatin Receptor[1]. |
| References |
| Molecular Formula | C56H68N12O14S2 |
|---|---|
| Molecular Weight | 1197.34 |
| Exact Mass | 1196.44000 |
| PSA | 474.81000 |
| LogP | 4.78680 |
| InChIKey | RDTVTSXTFYXNSG-HDNDNHAUSA-N |
| SMILES | CC(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)NC1CSSCC(C(=O)NC(Cc2ccc(O)cc2)C(N)=O)NC(=O)C(C(C)O)NC(=O)C(CCCCN)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(Cc2ccc(O)cc2)NC1=O |