N-butyl-D-gluconamide structure
|
Common Name | N-butyl-D-gluconamide | ||
|---|---|---|---|---|
| CAS Number | 18375-57-0 | Molecular Weight | 251.27700 | |
| Density | 1.332g/cm3 | Boiling Point | 635.2ºC at 760mmHg | |
| Molecular Formula | C10H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.9ºC | |
| Name | N-butyl-D-gluconamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 635.2ºC at 760mmHg |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.27700 |
| Flash Point | 337.9ºC |
| Exact Mass | 251.13700 |
| PSA | 130.25000 |
| Vapour Pressure | 8.35E-19mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | CRYAIAMXDBHCTJ-LURQLKTLSA-N |
| SMILES | CCCCNC(=O)C(O)C(O)C(O)C(O)CO |
| HS Code | 2924199090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Einecs 242-252-6 |
| D-Gluconamido-n-butan |