Urea,N-butyl-N',N'-diethyl-N-(trimethylsilyl)- structure
|
Common Name | Urea,N-butyl-N',N'-diethyl-N-(trimethylsilyl)- | ||
|---|---|---|---|---|
| CAS Number | 18388-99-3 | Molecular Weight | 244.44900 | |
| Density | 0.892g/cm3 | Boiling Point | 276.5ºC at 760mmHg | |
| Molecular Formula | C12H28N2OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121ºC | |
| Name | N-Trimethylsilyl-N-butyl-N',N'-diethylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 0.892g/cm3 |
|---|---|
| Boiling Point | 276.5ºC at 760mmHg |
| Molecular Formula | C12H28N2OSi |
| Molecular Weight | 244.44900 |
| Flash Point | 121ºC |
| Exact Mass | 244.19700 |
| PSA | 23.55000 |
| LogP | 3.38520 |
| Vapour Pressure | 0.00477mmHg at 25°C |
| Index of Refraction | 1.451 |
| InChIKey | UJPXKMUARILIQY-UHFFFAOYSA-N |
| SMILES | CCCCN(C(=O)N(CC)CC)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
|
~%
Urea,N-butyl-N'... CAS#:18388-99-3 |
| Literature: Fink,W. Chemische Berichte, 1964 , vol. 97, p. 1433 - 1438 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N-TRIMETHYLSILYL-N-N-BUTYL-N',N'-DIETHYLUREA |
| N-Trimethylsilyl-N-butyl-N,N'-diethyl-harnstoff |
| Einecs 242-267-8 |