1,6-bis(dichloromethylsilyl)hexane structure
|
Common Name | 1,6-bis(dichloromethylsilyl)hexane | ||
|---|---|---|---|---|
| CAS Number | 18395-97-6 | Molecular Weight | 312.21200 | |
| Density | 1.131 g/cm3 | Boiling Point | 119ºC | |
| Molecular Formula | C8H18Cl4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,6-bis(dichloromethylsilyl)hexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.131 g/cm3 |
|---|---|
| Boiling Point | 119ºC |
| Molecular Formula | C8H18Cl4Si2 |
| Molecular Weight | 312.21200 |
| Exact Mass | 309.97000 |
| LogP | 5.64600 |
| InChIKey | NDFFILGCGJJGOS-UHFFFAOYSA-N |
| SMILES | C[Si](Cl)(Cl)CCCCCC[Si](C)(Cl)Cl |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2987 |
| HS Code | 2931900090 |
|
~%
1,6-bis(dichlor... CAS#:18395-97-6 |
| Literature: Fink,W. Helvetica Chimica Acta, 1971 , vol. 54, p. 1304 - 1310 |
|
~%
1,6-bis(dichlor... CAS#:18395-97-6 |
| Literature: Kumada,M. et al. Bulletin of the Chemical Society of Japan, 1964 , vol. 37, # 6 p. 871 - 874 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,2,9,9-Tetrachloro-2,9-disiladecane |
| Si,Si,Si',Si'-tetrachloro-Si,Si'-dimethyl-Si,Si'-hexanediyl-bis-silane |
| Si,Si,Si',Si'-Tetrachlor-Si,Si'-dimethyl-Si,Si'-hexandiyl-bis-silan |