Dichloro(dioctyl)silane structure
|
Common Name | Dichloro(dioctyl)silane | ||
|---|---|---|---|---|
| CAS Number | 18416-07-4 | Molecular Weight | 325.433 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 340.3±10.0 °C at 760 mmHg | |
| Molecular Formula | C16H34Cl2Si | Melting Point | <0ºC | |
| MSDS | Chinese USA | Flash Point | 153.7±16.6 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | dichloro(dioctyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.3±10.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C16H34Cl2Si |
| Molecular Weight | 325.433 |
| Flash Point | 153.7±16.6 °C |
| Exact Mass | 324.180695 |
| LogP | 10.62 |
| Appearance of Characters | Liquid | Colorless to pale yellow |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.451 |
| InChIKey | CVAGYCLEIYGJQT-UHFFFAOYSA-N |
| SMILES | CCCCCCCC[Si](Cl)(Cl)CCCCCCCC |
| Water Solubility | Sparingly Soluble (8.8E-6 g/L) at 25°C. |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Hazard Codes | C |
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2987 |
| Packaging Group | II |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Synthesis, characterization, and photovoltaic properties of a low band gap polymer based on silole-containing polythiophenes and 2,1,3-benzothiadiazole.
J. Am. Chem. Soc. 130 , 16144-16145, (2008) A new low band gap silole-containing conjugated polymer, PSBTBT, was designed and synthesized. Photovoltaic properties of PSBTBT were initially investigated, and an average power conversion efficiency... |
|
|
Low band gap dithieno[3,2-b:2',3'-d]silole-containing polymers, synthesis, characterization and photovoltaic application.
Chem. Commun. (Camb.) 37 , 5570-5572, (2009) A series of low band gap silole-containing polymers were synthesized with different alkyl side chains and a power conversion efficiency (PCE) of 3.43% was obtained. |
|
|
Wang; J.-Y.; et al.
Chem. Mater. 23 , 765-767, (2011)
|
| Dichlorodioctylsilane |
| Dichloro(dioctyl)silane |
| Di-n-octyldichlorosilane |
| MFCD01074472 |
| Dioctyldichlorosilane |
| Silane, dichlorodioctyl- |
| dichloro-dioctyl-silane |
| dichlorobis-n-octylsilane |
| di-(n-octyl)dichlorosilane |
| (n-oct)2SiCl2 |
| Dichlorodi-n-octylsilane |
| Di-n-Octyl Dichlorosilane |