3-hydroxybenzaldehyde azine structure
|
Common Name | 3-hydroxybenzaldehyde azine | ||
|---|---|---|---|---|
| CAS Number | 18428-76-7 | Molecular Weight | 240.25700 | |
| Density | 1.17g/cm3 | Boiling Point | 450.9ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O2 | Melting Point | 208-212ºC | |
| MSDS | Chinese USA | Flash Point | 295.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-[(E)-[(E)-(3-hydroxyphenyl)methylidenehydrazinylidene]methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 450.9ºC at 760 mmHg |
| Melting Point | 208-212ºC |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.25700 |
| Flash Point | 295.7ºC |
| Exact Mass | 240.09000 |
| PSA | 65.18000 |
| LogP | 2.55080 |
| Vapour Pressure | 9.57E-09mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | RNYGIOAXUUJHOC-KAVGSWPWSA-N |
| SMILES | Oc1cccc(C=NN=Cc2cccc(O)c2)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Strategy for copper speciation in white wine by differential pulse anodic stripping voltammetry, potentiometry with an ion-selective electrode and kinetic photometric determination. Wiese C and Schwedt G.
Fresenius J. Anal. Chem. 358 (6) , 718-722, (1997)
|
|
|
Evaluation and Characteristics of a Tb 3+ Electrochemical Sensor Based on Plasticized Poly (vinyl chloride) Membrane. Zamani HA and Sahebnasagh S.
Int. J. Electrochem. Sci. 8 , 3696-3707, (2013)
|
|
|
A. Velasco et al.
Anal. Chim. Acta 229 , 107, (1990)
|
| Benzaldehyde,m-hydroxy-,azine |
| 3-Hydroxybenzaldehyde azine |