6-Chloro-2-phenyl-imidazo[1,2-b]pyridazine structure
|
Common Name | 6-Chloro-2-phenyl-imidazo[1,2-b]pyridazine | ||
|---|---|---|---|---|
| CAS Number | 1844-53-7 | Molecular Weight | 229.66500 | |
| Density | 1.353g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H8ClN3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 6-Chloro-2-phenylimidazo[1,2-b]pyridazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Molecular Formula | C12H8ClN3 |
| Molecular Weight | 229.66500 |
| Exact Mass | 229.04100 |
| PSA | 30.19000 |
| LogP | 3.04970 |
| Index of Refraction | 1.69 |
| InChIKey | FPWMERDSYDEJOP-UHFFFAOYSA-N |
| SMILES | Clc1ccc2nc(-c3ccccc3)cn2n1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phenyl-6-chloroimidazo<1,2-b>pyridazine |
| 6-chloro-2-phenylimidazo<1,2-b>pyridazine |
| GL-1076 |
| 2-Phenyl-6-chlor-imidazo<1,2-b>pyridazin |
| 6-Chlor-2-phenyl-imidazo<1,2-b>pyridazin |