Delta 5-avenasterol structure
|
Common Name | Delta 5-avenasterol | ||
|---|---|---|---|---|
| CAS Number | 18472-36-1 | Molecular Weight | 412.69100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H48O | Melting Point | 131-134 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Delta 5-avenasterolΔ5-Avenasterol, belongs to the components of oat grain , exhibits propounding antioxidant effectiveness[1]. |
| Name | δ5-Avenasterol |
|---|---|
| Synonym | More Synonyms |
| Description | Δ5-Avenasterol, belongs to the components of oat grain , exhibits propounding antioxidant effectiveness[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 131-134 °C |
|---|---|
| Molecular Formula | C29H48O |
| Molecular Weight | 412.69100 |
| Exact Mass | 412.37100 |
| PSA | 20.23000 |
| LogP | 7.94490 |
| InChIKey | OSELKOCHBMDKEJ-VEVYEIKRSA-N |
| SMILES | CC=C(CCC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C |
| Storage condition | 20 °C |
| Hazard Codes | F |
|---|
| (3β)-Stigmasta-5,24(28)-dien-3-ol |
| Stigmasta-5,24(28)-dien-3β-ol |
| 24(28)-Ethylidenecholest-5-en-3β-ol |
| 24-Ethylcholesta-5,24(28)-dien-3β-ol |
| 24-Ethylidenecholest-5-en-3β-ol |
| 24-Ethylidenecholesterol |
| Stigmasta-5,24(28)-dien-3-ol |
| Δ5-Avenasterin |
| Δ5-Avenosterol |
| (3S,8S,9S,10R,13R,14S,17R)-17-((R,Z)-5-isopropylhept-5-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |