(S)-Lercanidipine HCl structure
|
Common Name | (S)-Lercanidipine HCl | ||
|---|---|---|---|---|
| CAS Number | 184866-29-3 | Molecular Weight | 648.188 | |
| Density | N/A | Boiling Point | 712.5ºC at 760 mmHg | |
| Molecular Formula | C36H42ClN3O6 | Melting Point | 116-122ºC | |
| MSDS | N/A | Flash Point | 384.7ºC | |
Use of (S)-Lercanidipine HCl(S)-Lercanidipine hydrochloride is the S-enantiomer of Lercanidipine hydrochloride. (S)-lercanidipine hydrochloride is a potent calcium channel blocker[1]. |
| Name | 5-O-[1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-Lercanidipine hydrochloride is the S-enantiomer of Lercanidipine hydrochloride. (S)-lercanidipine hydrochloride is a potent calcium channel blocker[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 712.5ºC at 760 mmHg |
|---|---|
| Melting Point | 116-122ºC |
| Molecular Formula | C36H42ClN3O6 |
| Molecular Weight | 648.188 |
| Flash Point | 384.7ºC |
| Exact Mass | 647.276184 |
| PSA | 113.69000 |
| LogP | 8.13240 |
| Vapour Pressure | 3.77E-20mmHg at 25°C |
| InChIKey | WMFYOYKPJLRMJI-WAQYZQTGSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)(C)CN(C)CCC(c2ccccc2)c2ccccc2)C1c1cccc([N+](=O)[O-])c1.Cl |
| 1-[(3,3-Diphenylpropyl)(methyl)amino]-2-methyl-2-propanyl methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydro-3,5-pyridinedicarboxylate hydrochloride (1:1) |
| (4S)-1,4-Dihydro-2,6-dimethyl-4-(3-nittrophenyl)-3,5-pyridinedicarboxylic Acid 2-[(3,3-Diphenylpropyl)methylamino]-1,1-dimethylethyl Methyl Ester Hydrochloride |
| UNII-OA8TFX68PE component WMFYOYKPJLRMJI-WAQYZQTGSA-N |
| 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl methyl ester, (4S)-, hydrochloride (1:1) |
| (S)-Lercanidipine Hydrochloride |