2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde
2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde structure
|
Common Name | 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 185244-97-7 | Molecular Weight | 247.67700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10ClNO2 |
|---|---|
| Molecular Weight | 247.67700 |
| Exact Mass | 247.04000 |
| PSA | 39.19000 |
| LogP | 3.22310 |
| InChIKey | SRVKUMXTLCFSAX-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cnc(Cl)c(C=O)c2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
2-chloro-5-(4-m... CAS#:185244-97-7 |
| Literature: Gangadasu; Narender; Bharath Kumar; Ravinder; Ananda Rao; Ramesh; China Raju; Jayathirtha Rao Tetrahedron, 2006 , vol. 62, # 35 p. 8398 - 8403 |
|
~17%
2-chloro-5-(4-m... CAS#:185244-97-7 |
| Literature: Amaresh; Perumal Synthetic Communications, 2000 , vol. 30, # 13 p. 2269 - 2274 |
![N-[(1E)-2-(4-methoxyphenyl)ethenyl]acetamide structure](https://image.chemsrc.com/caspic/166/18797-94-9.png)
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde? |
| A: InChIKey of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde is SRVKUMXTLCFSAX-UHFFFAOYSA-N. |
| Q: What is the English name of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde? |
| A: The English name of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde is 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde. |
| Q: What is the Chinese name of 185244-97-7? |
| A: Chinese name of 185244-97-7 is 185244-97-7. |
| Q: What is the LogP of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde? |
| A: LogP of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde is 3.22310. |
| Q: What is the polar surface area (PSA) of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde? |
| A: Polar surface area (PSA) of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde is 39.19000. |
| Q: What is the molecular formula of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde? |
| A: Molecular formula of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde is C13H10ClNO2. |
| Q: What is the molecular weight of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde? |
| A: Molecular weight of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde is 247.67700. |
| Q: What is the CAS number of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde? |
| A: CAS number of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde is 185244-97-7. |
| Q: What is the SMILES notation of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde? |
| A: SMILES notation of 2-chloro-5-(4-methoxyphenyl)pyridine-3-carbaldehyde is COc1ccc(-c2cnc(Cl)c(C=O)c2)cc1. |