4-Chloro-2-methyl-7-(trifluoromethyl)quinoline structure
|
Common Name | 4-Chloro-2-methyl-7-(trifluoromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 18529-09-4 | Molecular Weight | 245.628 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 277.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H7ClF3N | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 121.5±25.9 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 4-chloro-2-methyl-7-(trifluoromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 277.2±35.0 °C at 760 mmHg |
| Molecular Formula | C11H7ClF3N |
| Molecular Weight | 245.628 |
| Flash Point | 121.5±25.9 °C |
| Exact Mass | 245.021912 |
| PSA | 12.89000 |
| LogP | 4.18 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | KQXIMYKBHAMAAM-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c2ccc(C(F)(F)F)cc2n1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H318 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | T |
| Risk Phrases | 25-41 |
| Safety Phrases | 26-39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
|
~99%
4-Chloro-2-meth... CAS#:18529-09-4 |
| Literature: INTERVET INTERNATIONAL B.V.; BERGER, Michael; KERN, Christopher; ECK, Marko; SCHROeDER, Joerg Patent: WO2012/41872 A1, 2012 ; Location in patent: Page/Page column 96 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Trifluormethyl-4-chlor-2-methyl-chinolin |
| MFCD00272334 |
| Quinoline, 4-chloro-2-methyl-7-(trifluoromethyl)- |
| 4-Chloro-2-methyl-7-trifluoromethylquinoline |
| 4-Chlor-7-trifluormethylchinaldin |
| 4-Chloro-2-methyl-7-(trifluoromethyl)quinoline |
| 4-chlor-2-methyl-7-trifluormethylchinolin |