2-Iodo-6-chloropurine structure
|
Common Name | 2-Iodo-6-chloropurine | ||
|---|---|---|---|---|
| CAS Number | 18552-90-4 | Molecular Weight | 280.45 | |
| Density | 2.5±0.1 g/cm3 | Boiling Point | 352.9±52.0 °C at 760 mmHg | |
| Molecular Formula | C5H2ClIN4 | Melting Point | 198-203°C | |
| MSDS | Chinese USA | Flash Point | 167.2±30.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Iodo-6-chloropurine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.9±52.0 °C at 760 mmHg |
| Melting Point | 198-203°C |
| Molecular Formula | C5H2ClIN4 |
| Molecular Weight | 280.45 |
| Flash Point | 167.2±30.7 °C |
| Exact Mass | 279.90127 |
| PSA | 54.46000 |
| LogP | 1.00 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.874 |
| InChIKey | SZRNPDHDBPGZOA-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)I)Cl |
| Storage condition | -20°C |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chloro-2-iodopurine |
| 2-iodo-6-chloro-9H-purine |
| 6-chloro-2-iodo-7H-purine |
| 6-Chloro-2-iodo-1H-purine |
| 9H-6-chloro-2-iodopurine |
| 4-Chloro-2-iodo-1H-pyrrolo[2,3-d]pyrimidine |