Viroallosecurinine structure
|
Common Name | Viroallosecurinine | ||
|---|---|---|---|---|
| CAS Number | 1857-30-3 | Molecular Weight | 217.26 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 459.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | 145-147 ºC (hexane acetone) | |
| MSDS | N/A | Flash Point | 197.0±19.6 °C | |
Use of Viroallosecurinine(+)-Viroallosecurinine, isolated from Securinega virosa as a cytotoxic alkaloid, exhibits a MIC of 0.48 μg/mL for Ps. Aeruginosa and Staph. aureus[1]. Antibacterial activity[1]. |
| Name | securinine |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-Viroallosecurinine, isolated from Securinega virosa as a cytotoxic alkaloid, exhibits a MIC of 0.48 μg/mL for Ps. Aeruginosa and Staph. aureus[1]. Antibacterial activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.0±45.0 °C at 760 mmHg |
| Melting Point | 145-147 ºC (hexane acetone) |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26 |
| Flash Point | 197.0±19.6 °C |
| Exact Mass | 217.110275 |
| PSA | 29.54000 |
| LogP | 0.60 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | SWZMSZQQJRKFBP-DMDPSCGWSA-N |
| SMILES | O=C1C=C2C=CC3CC2(O1)C1CCCCN31 |
| Hazard Codes | Xi |
|---|
| 8H-6,11b-Methanofuro[2,3-c]pyrido[1,2-a]azepin-2(6H)-one, 9,10,11,11a-tetrahydro- |
| 2-Oxo-2,6,9,10,11,11a-hexahydro-8H-6,11b-methanofuro(2,3-c)pyrido(1,2-a)azepin |
| 9,10,11,11a-tetrahydro-8H-6,11b-methanofuro[2,3-c]pyrido[1,2-a]azepin-2(6H)-one |
| 14-Oxa-7-azatetracyclo[6.6.1.0.0]pentadeca-9,11-dien-13-one |
| Securan-11-one |
| (+)-Viroallosecurinine |
| Viroallosecurinine |