3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro structure
|
Common Name | 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro | ||
|---|---|---|---|---|
| CAS Number | 1858250-49-3 | Molecular Weight | 710.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H42F12O6Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H42F12O6Si2 |
|---|---|
| Molecular Weight | 710.7 |
| InChIKey | YNANGIAQHBAVEA-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC[Si](OCC)(OCC)OCC)(OCC)OCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro? |
| A: InChIKey of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro is YNANGIAQHBAVEA-UHFFFAOYSA-N. |
| Q: What is the English name of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro? |
| A: The English name of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro is 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro. |
| Q: What is the CAS number of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro? |
| A: CAS number of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro is 1858250-49-3. |
| Q: What is the Chinese name of 1858250-49-3? |
| A: Chinese name of 1858250-49-3 is 1858250-49-3. |
| Q: What is the molecular weight of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro? |
| A: Molecular weight of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro is 710.7. |
| Q: What is the molecular formula of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro? |
| A: Molecular formula of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro is C24H42F12O6Si2. |
| Q: What is the SMILES notation of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro? |
| A: SMILES notation of 3,18-Dioxa-4,17-disilaeicosane, 4,4,17,17-tetraethoxy-8,8,9,9,10,10,11,11,12,12,13,13-dodecafluoro is CCO[Si](CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC[Si](OCC)(OCC)OCC)(OCC)OCC. |