diphenyl(2-(triethoxysilyl)ethyl)phosphine structure
|
Common Name | diphenyl(2-(triethoxysilyl)ethyl)phosphine | ||
|---|---|---|---|---|
| CAS Number | 18586-39-5 | Molecular Weight | 376.502 | |
| Density | 1.05 | Boiling Point | 410.9±28.0 °C at 760 mmHg | |
| Molecular Formula | C20H29O3PSi | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 202.3±24.0 °C | |
| Name | diphenyl(2-triethoxysilylethyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05 |
|---|---|
| Boiling Point | 410.9±28.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C20H29O3PSi |
| Molecular Weight | 376.502 |
| Flash Point | 202.3±24.0 °C |
| Exact Mass | 376.162354 |
| PSA | 41.28000 |
| LogP | 6.14 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| InChIKey | HLXCYTXLQJWQFG-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCP(c1ccccc1)c1ccccc1)(OCC)OCC |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 23-26-36/37/39 |
| HS Code | 2931900090 |
|
~98%
diphenyl(2-(tri... CAS#:18586-39-5 |
| Literature: Kroecher, Oliver; Koeppel, Rene A.; Froeba, Michael; Baiker, Alfons Journal of Catalysis, 1998 , vol. 178, # 1 p. 284 - 298 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-(Diphenylphosphino)Ethyltriethoxysilane |
| PHOSPHINE, DIPHENYL(2-(TRIETHOXYSILYL)ETHYL)- |
| Phosphine, diphenyl[2-(triethoxysilyl)ethyl]- |
| diphenyl(2-(triethoxysilyl)ethyl)phosphine |
| Diphenyl[2-(triethoxysilyl)ethyl]phosphine |
| diphenylethyltriethoxysilanephosphine |