1-Hexene,4,4-dichloro-5,5,6,6,6-pentafluoro-2-methyl- structure
|
Common Name | 1-Hexene,4,4-dichloro-5,5,6,6,6-pentafluoro-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 18599-03-6 | Molecular Weight | 257.02800 | |
| Density | 1.359g/cm3 | Boiling Point | 148.5ºC at 760mmHg | |
| Molecular Formula | C7H7Cl2F5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 61.8ºC | |
| Name | 4,4-dichloro-5,5,6,6,6-pentafluoro-2-methylhex-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 148.5ºC at 760mmHg |
| Molecular Formula | C7H7Cl2F5 |
| Molecular Weight | 257.02800 |
| Flash Point | 61.8ºC |
| Exact Mass | 255.98400 |
| LogP | 4.32410 |
| Vapour Pressure | 5.34mmHg at 25°C |
| Index of Refraction | 1.386 |
| InChIKey | WEUBIBBIUKVYEP-UHFFFAOYSA-N |
| SMILES | C=C(C)CC(Cl)(Cl)C(F)(F)C(F)(F)F |
|
~%
1-Hexene,4,4-di... CAS#:18599-03-6 |
| Literature: Tarrant,P.; Tandon,J.P. Journal of Organic Chemistry, 1969 , vol. 34, # 4 p. 864 - 869 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4-dichloro-5,5,6,6,6-pentafluoro-2-methyl-hex-1-ene |
| 1.1.1.2.2-Pentafluor-3.3-dichlor-5-methyl-hexen-(5) |
| 1-Hexene,4,4-dichloro-5,5,6,6,6-pentafluoro-2-methyl |