1,1,1-trichloropentafluoropropane structure
|
Common Name | 1,1,1-trichloropentafluoropropane | ||
|---|---|---|---|---|
| CAS Number | 4259-43-2 | Molecular Weight | 237.38300 | |
| Density | 1.646 g/cm3 | Boiling Point | 70-71ºC | |
| Molecular Formula | C3Cl3F5 | Melting Point | -80ºC | |
| MSDS | N/A | Flash Point | 3ºC | |
| Name | 1,1,1-trichloropentafluoropropane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.646 g/cm3 |
|---|---|
| Boiling Point | 70-71ºC |
| Melting Point | -80ºC |
| Molecular Formula | C3Cl3F5 |
| Molecular Weight | 237.38300 |
| Flash Point | 3ºC |
| Exact Mass | 235.89900 |
| LogP | 3.55420 |
| Index of Refraction | 1.3527 |
| InChIKey | HJRXHKBZNQULJQ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(Cl)(Cl)Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2903772024 |
|
~%
1,1,1-trichloro... CAS#:4259-43-2 |
| Literature: McBee et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 3149 |
|
~76%
Detail
|
| Literature: Tanuma, T.; Ohnishi, K.; Okamoto, H.; Miyajima, T.; Morikawa, S. Journal of Fluorine Chemistry, 1992 , vol. 57, p. 259 - 284 |
|
~%
Detail
|
| Literature: E.I. DU PONT DE NEMOURS AND COMPANY Patent: WO2009/79525 A2, 2009 ; Location in patent: Page/Page column 14 ; |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903772024 |
|---|---|
| Summary | 2903772024 1,2,2-trichloro-1,1,3,3,3-pentafluoropropane。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。Lowest tariff:5.5%。General tariff:30.0% |
| 1,1,1-trichloro-pentafluoro-propane |
| 2,2,3,3,3-pentafluoro-1,1,1-trichloropropane |
| R-215 |
| cfc215 |
| freon215 |
| 1,1,1-Trichlor-pentafluor-propan |
| 1,1,1-trichloropentafluoro-propan |
| 1,1,1-trichloro-2,2,3,3,3-pentafluoropropane |
| trichloropentafluoro-propane |