(Asn⁶⁷⁰,Leu6⁷¹)-Amyloid β/A4 Protein Precursor₇₇₀ (667-676) trifluoroacetate salt structure
|
Common Name | (Asn⁶⁷⁰,Leu6⁷¹)-Amyloid β/A4 Protein Precursor₇₇₀ (667-676) trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 186142-28-9 | Molecular Weight | 1179.237 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C50H78N14O19 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of (Asn⁶⁷⁰,Leu6⁷¹)-Amyloid β/A4 Protein Precursor₇₇₀ (667-676) trifluoroacetate saltSEVNLDAEFR is a substrate for BACE1[1]. |
| Name | [Asn670,Leu671]-Amyloid β/A4 Protein Precursor770 (667-676) |
|---|---|
| Synonym | More Synonyms |
| Description | SEVNLDAEFR is a substrate for BACE1[1]. |
|---|---|
| Related Catalog | |
| Target |
BACE1[1] |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C50H78N14O19 |
| Molecular Weight | 1179.237 |
| Exact Mass | 1178.556763 |
| PSA | 562.34000 |
| LogP | -1.78 |
| Appearance of Characters | solid |
| Index of Refraction | 1.646 |
| InChIKey | JONOLKHIDOKDGP-RDICLXJSSA-N |
| SMILES | CC(C)CC(NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(CCC(=O)O)NC(=O)C(N)CO)C(C)C)C(=O)NC(CC(=O)O)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| (ASN670,LEU671)-APP770 (667-676) |
| H-Ser-Glu-Val-Asn |
| SEVNLDAEFR |
| A4 PROTEIN PRECURSOR770 (667-676) |
| SER-GLU-VAL-ASN-LEU-ASP-ALA-GLU-PHE-ARG |
| H-SER-GLU-VAL-ASN-LEU-ASP-ALA-GLU-PHE-ARG-OH |
| MFCD03097426 |
| (Asn670,Leu671)-Amyloid β/A4 Protein Precursor770 (667-676) |