4-thioanisolemagnesium bromide structure
|
Common Name | 4-thioanisolemagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 18620-04-7 | Molecular Weight | 227.40400 | |
| Density | 0.965 g/mL at 25 °C | Boiling Point | 65 °C | |
| Molecular Formula | C7H7BrMgS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | <1 °F | |
| Name | magnesium,methylsulfanylbenzene,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965 g/mL at 25 °C |
|---|---|
| Boiling Point | 65 °C |
| Molecular Formula | C7H7BrMgS |
| Molecular Weight | 227.40400 |
| Flash Point | <1 °F |
| Exact Mass | 225.93000 |
| PSA | 25.30000 |
| LogP | 3.05430 |
| Appearance of Characters | Solution | Clear yellow to brown |
| InChIKey | RIHHDNYCTKOKAZ-UHFFFAOYSA-M |
| SMILES | CSc1cc[c-]cc1.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Hazard Codes | F,C,F+ |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | 16-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
|
~%
4-thioanisolema... CAS#:18620-04-7 |
| Literature: US2005/107305 A1, ; Page/Page column 30;33 ; |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-Thioanisolemagnesium bromide |
| (4-methylthio-phenyl)-magnesium bromide |
| 4-Thioanisolemagnesium bromide solution |
| (4-MeS-C6H4l)MgBr |
| 4-Thioanisolemagnesium bromide 0.5 M in Tetrahydrofuran |
| p-MeSC6H4MgBr |
| p-MeSPhMgBr |
| MFCD00672010 |