Butanedioic acid, 1,4-bis[2-[(phenylamino)thioxomethyl]hydrazide] structure
|
Common Name | Butanedioic acid, 1,4-bis[2-[(phenylamino)thioxomethyl]hydrazide] | ||
|---|---|---|---|---|
| CAS Number | 18670-38-7 | Molecular Weight | 416.52000 | |
| Density | 1.413g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H20N6O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[[4-oxo-4-[2-(phenylcarbamothioyl)hydrazinyl]butanoyl]amino]-3-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.413g/cm3 |
|---|---|
| Molecular Formula | C18H20N6O2S2 |
| Molecular Weight | 416.52000 |
| Exact Mass | 416.10900 |
| PSA | 170.50000 |
| LogP | 3.51180 |
| Index of Refraction | 1.726 |
| InChIKey | YFPLEDMOIVNQFF-UHFFFAOYSA-N |
| SMILES | O=C(CCC(=O)NNC(=S)Nc1ccccc1)NNC(=S)Nc1ccccc1 |
|
~78%
Butanedioic aci... CAS#:18670-38-7 |
| Literature: Srivastava; Bahel Journal of the Indian Chemical Society, 1991 , vol. 68, # 6 p. 365 - 367 |
| 4,4'-diphenyl-1,1'-succinyl-bis-thiosemicarbazide |
| 4,4'-Diphenylbis-succinylthiosemicarbazide |