5-[2-(5-anilino-1,3,4-thiadiazol-2-yl)ethyl]-N-phenyl-1,3,4-thiadiazol-2-amine structure
|
Common Name | 5-[2-(5-anilino-1,3,4-thiadiazol-2-yl)ethyl]-N-phenyl-1,3,4-thiadiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 72743-82-9 | Molecular Weight | 380.49000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[2-(5-anilino-1,3,4-thiadiazol-2-yl)ethyl]-N-phenyl-1,3,4-thiadiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H16N6S2 |
|---|---|
| Molecular Weight | 380.49000 |
| Exact Mass | 380.08800 |
| PSA | 138.56000 |
| LogP | 3.50580 |
| InChIKey | YFORXJHARDHLOL-UHFFFAOYSA-N |
| SMILES | c1ccc(Nc2nnc(CCc3nnc(Nc4ccccc4)s3)s2)cc1 |
|
~75%
5-[2-(5-anilino... CAS#:72743-82-9 |
| Literature: Srivastava; Bahel Journal of the Indian Chemical Society, 1991 , vol. 68, # 6 p. 365 - 367 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5,5'-dianilino-2,2'-ethane-1,2-diyl-bis-[1,3,4]thiadiazole |
| 1,3,4-Thiadiazol-2-amine,5,5'-(1,2-ethanediyl)bis[N-phenyl |
| 1,2-Bis(5-phenylamino-1,3,4-thiadiazol-2-yl)ethane |