2-hydroxy-5-nitro-alpha-toluenesulfonic acid structure
|
Common Name | 2-hydroxy-5-nitro-alpha-toluenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 18690-42-1 | Molecular Weight | 233.19900 | |
| Density | 1.733g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H7NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-hydroxy-5-nitrophenyl)methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.733g/cm3 |
|---|---|
| Molecular Formula | C7H7NO6S |
| Molecular Weight | 233.19900 |
| Exact Mass | 232.99900 |
| PSA | 128.80000 |
| LogP | 2.29220 |
| Index of Refraction | 1.653 |
| InChIKey | VZGUELDCIMLXIM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c(CS(=O)(=O)O)c1 |
| HS Code | 2906299090 |
|---|
|
~%
2-hydroxy-5-nit... CAS#:18690-42-1 |
| Literature: Bayer and Co. Patent: DE150313 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 7, p. 96 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-Hnats |
| Benzenemethanesulfonic acid,2-hydroxy-5-nitro |