2-chloromethyl-4-nitrophenol structure
|
Common Name | 2-chloromethyl-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 2973-19-5 | Molecular Weight | 187.58000 | |
| Density | 1.472g/cm3 | Boiling Point | 373.4ºC at 760 mmHg | |
| Molecular Formula | C7H6ClNO3 | Melting Point | 128 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | 179.6ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2-(Chloromethyl)-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.472g/cm3 |
|---|---|
| Boiling Point | 373.4ºC at 760 mmHg |
| Melting Point | 128 °C (dec.)(lit.) |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58000 |
| Flash Point | 179.6ºC |
| Exact Mass | 187.00400 |
| PSA | 66.05000 |
| LogP | 2.56240 |
| Vapour Pressure | 4.2E-06mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | PJNPZIYGODMAQE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c(CCl)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | 34 |
| Safety Phrases | S26-S27-S28-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | SK5060000 |
| HS Code | 2908999090 |
|
~71%
2-chloromethyl-... CAS#:2973-19-5 |
| Literature: Crans, Debbie C.; Boukhobza, Iman Journal of the American Chemical Society, 1998 , vol. 120, # 32 p. 8069 - 8078 |
|
~%
2-chloromethyl-... CAS#:2973-19-5 |
| Literature: Organic Syntheses, , vol. 20, p. 61 |
|
~%
2-chloromethyl-... CAS#:2973-19-5 |
| Literature: DE132475 ; Justus Liebigs Annalen der Chemie, , vol. 343, p. 245 |
|
~%
2-chloromethyl-... CAS#:2973-19-5 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 343, p. 245 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-(chloromethyl)-4-nitrophenol |
| EINECS 221-012-4 |
| MFCD00007341 |