2-(butylamino)-3-methylnaphthalene-1,4-dione structure
|
Common Name | 2-(butylamino)-3-methylnaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 18690-80-7 | Molecular Weight | 243.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(butylamino)-3-methylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17NO2 |
|---|---|
| Molecular Weight | 243.30100 |
| Exact Mass | 243.12600 |
| PSA | 46.17000 |
| LogP | 3.12020 |
| InChIKey | NFFLYRHGZUIVAE-UHFFFAOYSA-N |
| SMILES | CCCCNC1=C(C)C(=O)c2ccccc2C1=O |
| HS Code | 2922399090 |
|---|
|
~54%
2-(butylamino)-... CAS#:18690-80-7 |
| Literature: Ohta; Hinata; Kawasaki; Yamashita Chemical and Pharmaceutical Bulletin, 1994 , vol. 42, # 11 p. 2360 - 2362 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Methyl-3-butylamino-naphthochinon-1,4 |
| 3-Butylamino-2-methyl-1,4-naphthochinon |