Benzenesulfonicacid, 4-methyl-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazide
Modify Date: 2025-08-23 13:57:01
![Benzenesulfonicacid, 4-methyl-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazide Structure](https://image.chemsrc.com/caspic/367/18708-16-2.png)
Benzenesulfonicacid, 4-methyl-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazide structure
|
Common Name | Benzenesulfonicacid, 4-methyl-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 18708-16-2 | Molecular Weight | 317.40600 | |
| Density | 1.17g/cm3 | Boiling Point | 482.6ºC at 760mmHg | |
| Molecular Formula | C16H19N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.7ºC | |
| Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 482.6ºC at 760mmHg |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.40600 |
| Flash Point | 245.7ºC |
| Exact Mass | 317.12000 |
| PSA | 70.15000 |
| LogP | 3.84510 |
| Vapour Pressure | 1.8E-09mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | GMMHANXVXWEFGR-SFQUDFHCSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=Cc2ccc(N(C)C)cc2)cc1 |
|
~%
Benzenesulfonic... CAS#:18708-16-2 |
| Literature: Feng, Xing-Wen; Wang, Jian; Zhang, Ji; Yang, Jing; Wang, Na; Yu, Xiao-Qi Organic Letters, 2010 , vol. 12, # 19 p. 4408 - 4411 |
|
~%
Benzenesulfonic... CAS#:18708-16-2 |
| Literature: Kumar; Singh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 7 p. 579 - 583 |
CAS#:1931-49-3
CAS#:99-97-8![N,N-dimethyl-4-[(4-methylphenyl)sulfonylmethyl]aniline structure](https://image.chemsrc.com/caspic/360/33933-62-9.png)
CAS#:33933-62-9
CAS#:1703-46-4| 4-dimethylaminobenzaldehyde tosylhydrazone |
| p-(dimethylamino)benzaldehyde tosylhydrazone |
| 4-dimethylaminobenzaldehyde p-toluenesulfonylhydrazone |
| N'-[4-(dimethylamino)benzylidene]-4-methylbenzenesulfonohydrazide |
| 4-Dimethylamino-1-<p-toluolsulfonyl-hydrazono-methyl>-benzol |
| CCG-155 |
| 4-Dimethylamino-benzaldehyd-p-tosylhydrazon |
| {(1E)-2-[4-(dimethylamino)phenyl]-1-azavinyl}[(4-methylphenyl)sulfonyl]amine |