2,5-BIS(1,1-DIMETHYLETHYL)-PYRAZINE structure
|
Common Name | 2,5-BIS(1,1-DIMETHYLETHYL)-PYRAZINE | ||
|---|---|---|---|---|
| CAS Number | 18709-51-8 | Molecular Weight | 192.30100 | |
| Density | 0.918g/cm3 | Boiling Point | 242.3ºC at 760mmHg | |
| Molecular Formula | C12H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.2ºC | |
| Name | 2,5-ditert-butylpyrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.918g/cm3 |
|---|---|
| Boiling Point | 242.3ºC at 760mmHg |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.30100 |
| Flash Point | 95.2ºC |
| Exact Mass | 192.16300 |
| PSA | 25.78000 |
| LogP | 3.07160 |
| Vapour Pressure | 0.0532mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | NMMZWWJVCYMQAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cnc(C(C)(C)C)cn1 |
| HS Code | 2933990090 |
|---|
|
~%
2,5-BIS(1,1-DIM... CAS#:18709-51-8 |
| Literature: Suzuki, Hitomi; Kawaguchi, Takashi; Takaoka, Koji Bulletin of the Chemical Society of Japan, 1986 , vol. 59, # 2 p. 665 - 666 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrazine,2,5-di-tert-butyl |
| 2,4-DICHLORO-5-CYANOTHIAZOLE |
| 2,5-Di-t-butylpyrazin |
| 2,5-Di-tert-butylpyrazine |