1-azido-3,3-dimethylbutan-2-one structure
|
Common Name | 1-azido-3,3-dimethylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 76779-98-1 | Molecular Weight | 141.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-azido-3,3-dimethylbutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H11N3O |
|---|---|
| Molecular Weight | 141.17100 |
| Exact Mass | 141.09000 |
| PSA | 66.82000 |
| LogP | 1.36466 |
| InChIKey | CXEKPSNTAJVJNI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CN=[N+]=[N-] |
|
~99%
1-azido-3,3-dim... CAS#:76779-98-1 |
| Literature: ABBOTT LABORATORIES Patent: WO2006/122250 A2, 2006 ; Location in patent: Page/Page column 40 ; WO 2006/122250 A2 |
|
~99%
1-azido-3,3-dim... CAS#:76779-98-1 |
| Literature: CURIS, INC.; QIAN, Changgeng; CAI, Xiong; ZHAI, Haixiao Patent: WO2010/75542 A1, 2010 ; Location in patent: Page/Page column 50-51 ; |
|
~82%
1-azido-3,3-dim... CAS#:76779-98-1 |
| Literature: Kumar, Anil; Ahmed, Israr; Rao; Patel, Gautam; Kumar, Dalip Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2009 , vol. 48, # 4 p. 611 - 616 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| 1-azido-3,3-dimethyl-butan-2-one |
| 1-azido-3,3-dimethyl-2-butanone |
| 2-Butanone,1-azido-3,3-dimethyl |
| 1-Azido-3,3-dimethyl-butan-2-on |