Nateglinide Ethyl Ester structure
|
Common Name | Nateglinide Ethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 187728-85-4 | Molecular Weight | 345.47600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H31NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Nateglinide Ethyl Ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H31NO3 |
|---|---|
| Molecular Weight | 345.47600 |
| Exact Mass | 345.23000 |
| PSA | 58.89000 |
| LogP | 4.57970 |
| InChIKey | AVOHCDLQBWDQOF-CTWPCTMYSA-N |
| SMILES | CCOC(=O)C(Cc1ccccc1)NC(=O)C1CCC(C(C)C)CC1 |
|
~%
Nateglinide Eth... CAS#:187728-85-4 |
| Literature: BOARD OF REGENTS, THE UNIVERSITY OF TEXAS SYSTEM Patent: WO2005/27981 A1, 2005 ; Location in patent: Page/Page column 10; sheet 1 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ethyl (2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate |