1,4-dimethoxy-2-(2-nitroprop-1-enyl)benzene structure
|
Common Name | 1,4-dimethoxy-2-(2-nitroprop-1-enyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 18790-57-3 | Molecular Weight | 223.22500 | |
| Density | 1.168g/cm3 | Boiling Point | 355.7ºC at 760mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.8ºC | |
| Name | 1,4-dimethoxy-2-(2-nitroprop-1-enyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 355.7ºC at 760mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 157.8ºC |
| Exact Mass | 223.08400 |
| PSA | 64.28000 |
| LogP | 2.86450 |
| Vapour Pressure | 6.31E-05mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | MQFREHNTGKNSRH-VURMDHGXSA-N |
| SMILES | COc1ccc(OC)c(C=C(C)[N+](=O)[O-])c1 |
| HS Code | 2909309090 |
|---|
|
~88%
1,4-dimethoxy-2... CAS#:18790-57-3 |
| Literature: Rosowsky, Andre; Mota, Clara E.; Wright, Joel E.; Freisheim, James H.; Heusner, James J.; et al. Journal of Medicinal Chemistry, 1993 , vol. 36, # 21 p. 3103 - 3112 |
|
~%
1,4-dimethoxy-2... CAS#:18790-57-3 |
| Literature: Chemische Berichte, , vol. 50, p. 635 Chemische Berichte, , vol. 52, p. 1431 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,1,4-dimethoxy-2-(2-nitro-1-propenyl) |
| 1-(2,5-Dimethoxyphenyl)-2-nitropropene |
| EINECS 242-573-1 |
| 1-(2,5-Dimethoxy-phenyl)-2-nitro-prop-1-en |
| 1,4-Dimethoxy-2-(2-nitro-propenyl)-benzol |
| 1,4-dimethoxy-2-(2-nitro-propenyl)-benzene |
| 1-(2,5-dimethoxyphenyl)-2-nitro-1-propene |