Genistein-2',3',5',6'-d4 structure
|
Common Name | Genistein-2',3',5',6'-d4 | ||
|---|---|---|---|---|
| CAS Number | 187960-08-3 | Molecular Weight | 274.262 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 555.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H6D4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.1±23.6 °C | |
Use of Genistein-2',3',5',6'-d4Genistein-d4 is intended for use as an internal standard for the quantification of genistein by GC- or LC-MS. |
| Name | 5,7-dihydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 555.5±50.0 °C at 760 mmHg |
| Molecular Formula | C15H6D4O5 |
| Molecular Weight | 274.262 |
| Flash Point | 217.1±23.6 °C |
| Exact Mass | 274.077942 |
| PSA | 90.90000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.732 |
| InChIKey | TZBJGXHYKVUXJN-RHQRLBAQSA-N |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(O)c12 |
|
~%
Genistein-2',3'... CAS#:187960-08-3 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 49, # 11 p. 973 - 978 |
|
~%
Genistein-2',3'... CAS#:187960-08-3 |
| Literature: Tetrahedron Letters, , vol. 38, # 41 p. 7287 - 7290 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Baichanin A-d4 |
| 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(4-hydroxyphenyl-2,3,5,6-d)- |
| 4',5,7-Trihydroxyisoflavone-d4 |
| Genisteol-d4 |
| Bonistein-d4 |
| GeniVida-d4 |
| 2',3',5',6'-tetradeuterogenistein |
| Sophoricol-d4 |
| 5,7-Dihydroxy-3-[4-hydroxy(H)phenyl]-4H-chromen-4-one |
| Prunetol-d4 |