5-fluoro-2-methoxyphenylmagnesium bromide structure
|
Common Name | 5-fluoro-2-methoxyphenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 188132-02-7 | Molecular Weight | 229.32900 | |
| Density | 0.948 g/mL at 25 °C | Boiling Point | 65 °C | |
| Molecular Formula | C7H6BrFMgO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,1-fluoro-4-methoxybenzene-5-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.948 g/mL at 25 °C |
|---|---|
| Boiling Point | 65 °C |
| Molecular Formula | C7H6BrFMgO |
| Molecular Weight | 229.32900 |
| Flash Point | 1 °F |
| Exact Mass | 227.94400 |
| PSA | 9.23000 |
| LogP | 2.48010 |
| Appearance of Characters | Solution | Clear yellow to brown |
| Vapour Pressure | 3.51mmHg at 25°C |
| InChIKey | PLZMVUFJFASKEU-UHFFFAOYSA-M |
| SMILES | COc1[c-]cc(F)cc1.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | 16-26-33-36/37/39-43-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| Hazard Class | 3.0 |
| HS Code | 29310099 |
|
~%
5-fluoro-2-meth... CAS#:188132-02-7 |
| Literature: WO2005/61499 A1, ; Page/Page column 25-26 ; WO 2005/061499 A1 |
| PC9851 |
| 5-Fluoro-2-methoxyphenylmagnesium bromide |
| 3-Fluoro-6-methoxyphenylmagnesium bromide solution |
| 3-fluoro-6-methoxyphenylmagnesium bromide |
| 5-Fluoro-2-methoxyphenylmagnesium bromide 0.5M solution in THF |
| 5-Fluoro-2-methoxyphenylmagnesium bromide solution |
| bromo(5-fluoro-2-methoxyphenyl)magnesium |
| 5-Fluoro-2-methoxyphenylmagnesium bromide 0.5 M in Tetrahydrofuran |
| MFCD01311481 |
| (5-fluoro-2-methoxyphenyl)magnesium bromide |