ZLN024 hydrochloride structure
|
Common Name | ZLN024 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1883548-91-1 | Molecular Weight | 361.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14BrClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ZLN024 hydrochlorideZLN024 hydrochloride is an AMPK allosteric activator. ZLN024 directly activates recombinant AMPK α1β1γ1, AMPK α2β1γ1, AMPK α1β2γ1 and AMPK α2β2γ1 heterotrimer with EC50s of 0.42 M, 0.95 M, 1.1 M an |
| Name | ZLN-024 hydrochloride |
|---|
| Molecular Formula | C13H14BrClN2OS |
|---|---|
| Molecular Weight | 361.68 |
| InChIKey | MMQCYIMDROWWFE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCCSc2ncccn2)c(Br)c1.Cl |